C11H15NOS — CID 129015914
2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]pyrrolidine (PubChem CID 129015914) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]pyrrolidine.
| Compound Name | 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]pyrrolidine |
|---|---|
| PubChem CID | 129015914 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]pyrrolidine |
| SMILES | c1cc2c(s1)[C@H](C1CCCN1)OCC2 |
| InChI | InChI=1S/C11H15NOS/c1-2-9(12-5-1)10-11-8(3-6-13-10)4-7-14-11/h4,7,9-10,12H,1-3,5-6H2/t9?,10-/m0/s1 |
| InChIKey | XXGOWWQYQBPPPW-AXDSSHIGSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |