C19H21NO4S — CID 129016123
[4-[(1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl] acetate (PubChem CID 129016123) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is [4-[(1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl] acetate.
| Compound Name | [4-[(1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 129016123 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [4-[(1,1-dioxo-6-phenylthiazinan-2-yl)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CN2CCCC(c3ccccc3)S2(=O)=O)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-15(21)24-18-11-9-16(10-12-18)14-20-13-5-8-19(25(20,22)23)17-6-3-2-4-7-17/h2-4,6-7,9-12,19H,5,8,13-14H2,1H3 |
| InChIKey | UCSGUJHRPPWPLG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|