C12H22N2 — CID 129019234
1,2-dimethyl-3-(4-methylcyclohexyl)-2H-imidazole (PubChem CID 129019234) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1,2-dimethyl-3-(4-methylcyclohexyl)-2H-imidazole.
| Compound Name | 1,2-dimethyl-3-(4-methylcyclohexyl)-2H-imidazole |
|---|---|
| PubChem CID | 129019234 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1,2-dimethyl-3-(4-methylcyclohexyl)-2H-imidazole |
| SMILES | CC1CCC(N2C=CN(C)C2C)CC1 |
| InChI | InChI=1S/C12H22N2/c1-10-4-6-12(7-5-10)14-9-8-13(3)11(14)2/h8-12H,4-7H2,1-3H3 |
| InChIKey | SCUYGCDTXIYAHX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |