C14H23I2N3Pt — CID 87352253
[1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocyclopropanamine (PubChem CID 87352253) has the molecular formula C14H23I2N3Pt and a molecular weight of 682.24 g/mol. Its IUPAC name is [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocyclopropanamine.
| Compound Name | [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocyclopropanamine |
|---|---|
| PubChem CID | 87352253 |
| Molecular Formula | C14H23I2N3Pt |
| Molecular Weight | 682.24 g/mol |
| Exact Mass | 681.96 |
| IUPAC Name | [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocyclopropanamine |
| SMILES | Cn1ccn(CC2CCCCC2)c1=[Pt].IN(I)C1CC1 |
| InChI | InChI=1S/C11H18N2.C3H5I2N.Pt/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;4-6(5)3-1-2-3;/h7-8,11H,2-6,9H2,1H3;3H,1-2H2; |
| InChIKey | ROHJSLXEEIBAQY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|