C15H25I2N3Pt — CID 87352017
[1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocyclobutanamine (PubChem CID 87352017) has the molecular formula C15H25I2N3Pt and a molecular weight of 696.27 g/mol. Its IUPAC name is [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocyclobutanamine.
| Compound Name | [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocyclobutanamine |
|---|---|
| PubChem CID | 87352017 |
| Molecular Formula | C15H25I2N3Pt |
| Molecular Weight | 696.27 g/mol |
| Exact Mass | 695.98 |
| IUPAC Name | [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocyclobutanamine |
| SMILES | Cn1ccn(CC2CCCCC2)c1=[Pt].IN(I)C1CCC1 |
| InChI | InChI=1S/C11H18N2.C4H7I2N.Pt/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;5-7(6)4-2-1-3-4;/h7-8,11H,2-6,9H2,1H3;4H,1-3H2; |
| InChIKey | IZKHDFPAQDEPAL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.27 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|