C23H17Cl2N3O — CID 129026371
4-chloro-N-[N'-[1-(4-chlorophenyl)-3-phenylprop-2-ynyl]carbamimidoyl]benzamide (PubChem CID 129026371) has the molecular formula C23H17Cl2N3O and a molecular weight of 422.32 g/mol. Its IUPAC name is 4-chloro-N-[N'-[1-(4-chlorophenyl)-3-phenylprop-2-ynyl]carbamimidoyl]benzamide.
| Compound Name | 4-chloro-N-[N'-[1-(4-chlorophenyl)-3-phenylprop-2-ynyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 129026371 |
| Molecular Formula | C23H17Cl2N3O |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 4-chloro-N-[N'-[1-(4-chlorophenyl)-3-phenylprop-2-ynyl]carbamimidoyl]benzamide |
| SMILES | N/C(=N\C(C#Cc1ccccc1)c1ccc(Cl)cc1)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O/c24-19-11-7-17(8-12-19)21(15-6-16-4-2-1-3-5-16)27-23(26)28-22(29)18-9-13-20(25)14-10-18/h1-5,7-14,21H,(H3,26,27,28,29) |
| InChIKey | NIMWSNIGXWZDSG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|