C24H17ClN2O — CID 6304716
4-chloro-N-[(E)-[(E)-1,5-diphenylpent-1-en-4-yn-3-ylidene]amino]benzamide (PubChem CID 6304716) has the molecular formula C24H17ClN2O and a molecular weight of 384.87 g/mol. Its IUPAC name is 4-chloro-N-[(E)-[(E)-1,5-diphenylpent-1-en-4-yn-3-ylidene]amino]benzamide.
| Compound Name | 4-chloro-N-[(E)-[(E)-1,5-diphenylpent-1-en-4-yn-3-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 6304716 |
| Molecular Formula | C24H17ClN2O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-chloro-N-[(E)-[(E)-1,5-diphenylpent-1-en-4-yn-3-ylidene]amino]benzamide |
| SMILES | O=C(N/N=C(C#Cc1ccccc1)\C=C\c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17ClN2O/c25-22-15-13-21(14-16-22)24(28)27-26-23(17-11-19-7-3-1-4-8-19)18-12-20-9-5-2-6-10-20/h1-11,13-17H,(H,27,28)/b17-11+,26-23+ |
| InChIKey | FXMMSABIKXWHKV-MLOFANIRSA-N |
| XLogP | 5.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|