About 9H-fluoren-9-ylmethyl methyl hydrogen phosphate
9H-fluoren-9-ylmethyl methyl hydrogen phosphate (PubChem CID 129027379) has the molecular formula C15H15O4P
and a molecular weight of 290.25 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl methyl hydrogen phosphate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl methyl hydrogen phosphate |
| PubChem CID | 129027379 |
| Molecular Formula | C15H15O4P |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 9H-fluoren-9-ylmethyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H15O4P/c1-18-20(16,17)19-10-15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-9,15H,10H2,1H3,(H,16,17) |
| InChIKey | VYFFHZZVSGKFGE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethyl methyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl methyl hydrogen phosphate?
The IUPAC name of 9H-fluoren-9-ylmethyl methyl hydrogen phosphate (CID 129027379) is 9H-fluoren-9-ylmethyl methyl hydrogen phosphate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl methyl hydrogen phosphate?
The canonical SMILES for 9H-fluoren-9-ylmethyl methyl hydrogen phosphate is COP(=O)(O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-ylmethyl methyl hydrogen phosphate?
The InChIKey is VYFFHZZVSGKFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15O4P/c1-18-20(16,17)19-10-15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-9,15H,10H2,1H3,(H,16,17).
What are the key properties of 9H-fluoren-9-ylmethyl methyl hydrogen phosphate?
9H-fluoren-9-ylmethyl methyl hydrogen phosphate has a molecular weight of 290.25 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl methyl hydrogen phosphate is sourced from PubChem (CID 129027379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).