C4H10N2O — CID 129030503
(3R)-3,4-diaminobut-1-en-2-ol (PubChem CID 129030503) has the molecular formula C4H10N2O and a molecular weight of 102.14 g/mol. Its IUPAC name is (3R)-3,4-diaminobut-1-en-2-ol.
| Compound Name | (3R)-3,4-diaminobut-1-en-2-ol |
|---|---|
| PubChem CID | 129030503 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | (3R)-3,4-diaminobut-1-en-2-ol |
| SMILES | C=C(O)[C@H](N)CN |
| InChI | InChI=1S/C4H10N2O/c1-3(7)4(6)2-5/h4,7H,1-2,5-6H2/t4-/m1/s1 |
| InChIKey | RGLAYANYMGIVDU-SCSAIBSYSA-N |
| XLogP | -0.66 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|