2,3-diaminopropanoyl(methyl)carbamic acid

C5H11N3O3 — CID 175867666

IUPAC2,3-diaminopropanoyl(methyl)carbamic acid
SMILESCN(C(=O)O)C(=O)C(N)CN
InChIInChI=1S/C5H11N3O3/c1-8(5(10)11)4(9)3(7)2-6/h3H,2,6-7H2,1H3,(H,10,11)
InChIKeySEZJKAMIMKANGA-UHFFFAOYSA-N
MW161.16 g/mol
LogP-1.59
Rot. Bonds2

About 2,3-diaminopropanoyl(methyl)carbamic acid

2,3-diaminopropanoyl(methyl)carbamic acid (PubChem CID 175867666) has the molecular formula C5H11N3O3 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2,3-diaminopropanoyl(methyl)carbamic acid.

Molecular Properties

Compound Name2,3-diaminopropanoyl(methyl)carbamic acid
PubChem CID175867666
Molecular FormulaC5H11N3O3
Molecular Weight161.16 g/mol
Exact Mass161.08
IUPAC Name2,3-diaminopropanoyl(methyl)carbamic acid
SMILESCN(C(=O)O)C(=O)C(N)CN
InChIInChI=1S/C5H11N3O3/c1-8(5(10)11)4(9)3(7)2-6/h3H,2,6-7H2,1H3,(H,10,11)
InChIKeySEZJKAMIMKANGA-UHFFFAOYSA-N
XLogP-1.59
TPSA109.65 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 5-1.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2,3-diaminopropanoyl(methyl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-diaminopropanoyl(methyl)carbamic acid?
The IUPAC name of 2,3-diaminopropanoyl(methyl)carbamic acid (CID 175867666) is 2,3-diaminopropanoyl(methyl)carbamic acid.
What is the SMILES notation for 2,3-diaminopropanoyl(methyl)carbamic acid?
The canonical SMILES for 2,3-diaminopropanoyl(methyl)carbamic acid is CN(C(=O)O)C(=O)C(N)CN.
What is the InChIKey of 2,3-diaminopropanoyl(methyl)carbamic acid?
The InChIKey is SEZJKAMIMKANGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O3/c1-8(5(10)11)4(9)3(7)2-6/h3H,2,6-7H2,1H3,(H,10,11).
What are the key properties of 2,3-diaminopropanoyl(methyl)carbamic acid?
2,3-diaminopropanoyl(methyl)carbamic acid has a molecular weight of 161.16 g/mol, XLogP of -1.59, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diaminopropanoyl(methyl)carbamic acid is sourced from PubChem (CID 175867666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).