C11H21N2P — CID 129032149
(Z,3E)-3-[(Z)-but-2-enylidene]-N-phosphanyl-N'-propan-2-ylbut-1-ene-1,4-diamine (PubChem CID 129032149) has the molecular formula C11H21N2P and a molecular weight of 212.28 g/mol. Its IUPAC name is (Z,3E)-3-[(Z)-but-2-enylidene]-N-phosphanyl-N'-propan-2-ylbut-1-ene-1,4-diamine.
| Compound Name | (Z,3E)-3-[(Z)-but-2-enylidene]-N-phosphanyl-N'-propan-2-ylbut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 129032149 |
| Molecular Formula | C11H21N2P |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (Z,3E)-3-[(Z)-but-2-enylidene]-N-phosphanyl-N'-propan-2-ylbut-1-ene-1,4-diamine |
| SMILES | C/C=C\C=C(/C=C\NP)CNC(C)C |
| InChI | InChI=1S/C11H21N2P/c1-4-5-6-11(7-8-13-14)9-12-10(2)3/h4-8,10,12-13H,9,14H2,1-3H3/b5-4-,8-7-,11-6+ |
| InChIKey | XLCUGIXDLAOXCX-NWSIQZGGSA-N |
| XLogP | 2.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|