C15H23N3 — CID 118145985
(1Z,4E)-1-N-ethenyl-2-methyl-5-N-[(3Z)-3-methylhexa-1,3,5-trien-2-yl]penta-1,4-diene-1,3,5-triamine (PubChem CID 118145985) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (1Z,4E)-1-N-ethenyl-2-methyl-5-N-[(3Z)-3-methylhexa-1,3,5-trien-2-yl]penta-1,4-diene-1,3,5-triamine.
| Compound Name | (1Z,4E)-1-N-ethenyl-2-methyl-5-N-[(3Z)-3-methylhexa-1,3,5-trien-2-yl]penta-1,4-diene-1,3,5-triamine |
|---|---|
| PubChem CID | 118145985 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (1Z,4E)-1-N-ethenyl-2-methyl-5-N-[(3Z)-3-methylhexa-1,3,5-trien-2-yl]penta-1,4-diene-1,3,5-triamine |
| SMILES | C=C/C=C(/C)C(=C)N/C=C/C(N)/C(C)=C\NC=C |
| InChI | InChI=1S/C15H23N3/c1-6-8-12(3)14(5)18-10-9-15(16)13(4)11-17-7-2/h6-11,15,17-18H,1-2,5,16H2,3-4H3/b10-9+,12-8-,13-11- |
| InChIKey | OAIVNRQMKBMMIR-GDWUBNLWSA-N |
| XLogP | 2.70 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|