C5H10N2 — CID 142054604
(E)-1-N-ethenylprop-1-ene-1,2-diamine (PubChem CID 142054604) has the molecular formula C5H10N2 and a molecular weight of 98.15 g/mol. Its IUPAC name is (E)-1-N-ethenylprop-1-ene-1,2-diamine.
| Compound Name | (E)-1-N-ethenylprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 142054604 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | (E)-1-N-ethenylprop-1-ene-1,2-diamine |
| SMILES | C=CN/C=C(\C)N |
| InChI | InChI=1S/C5H10N2/c1-3-7-4-5(2)6/h3-4,7H,1,6H2,2H3/b5-4+ |
| InChIKey | RFFXKUGRTBYNMM-SNAWJCMRSA-N |
| XLogP | 0.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |