C8H15N5 — CID 174013930
(1Z,3Z)-1-N',4-N-bis(ethenyl)buta-1,3-diene-1,1,2,3,4-pentamine (PubChem CID 174013930) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is (1Z,3Z)-1-N',4-N-bis(ethenyl)buta-1,3-diene-1,1,2,3,4-pentamine.
| Compound Name | (1Z,3Z)-1-N',4-N-bis(ethenyl)buta-1,3-diene-1,1,2,3,4-pentamine |
|---|---|
| PubChem CID | 174013930 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (1Z,3Z)-1-N',4-N-bis(ethenyl)buta-1,3-diene-1,1,2,3,4-pentamine |
| SMILES | C=CN/C=C(N)/C(N)=C(\N)NC=C |
| InChI | InChI=1S/C8H15N5/c1-3-12-5-6(9)7(10)8(11)13-4-2/h3-5,12-13H,1-2,9-11H2/b6-5-,8-7- |
| InChIKey | PCPYHNINVZLDMS-ISTTXYCBSA-N |
| XLogP | -0.66 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|