C12H17N2OP — CID 129035962
(3R,5S,6R)-6-methyl-5-phenyl-3-(phosphanylamino)piperidin-2-one (PubChem CID 129035962) has the molecular formula C12H17N2OP and a molecular weight of 236.26 g/mol. Its IUPAC name is (3R,5S,6R)-6-methyl-5-phenyl-3-(phosphanylamino)piperidin-2-one.
| Compound Name | (3R,5S,6R)-6-methyl-5-phenyl-3-(phosphanylamino)piperidin-2-one |
|---|---|
| PubChem CID | 129035962 |
| Molecular Formula | C12H17N2OP |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (3R,5S,6R)-6-methyl-5-phenyl-3-(phosphanylamino)piperidin-2-one |
| SMILES | C[C@H]1NC(=O)[C@H](NP)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H17N2OP/c1-8-10(9-5-3-2-4-6-9)7-11(14-16)12(15)13-8/h2-6,8,10-11,14H,7,16H2,1H3,(H,13,15)/t8-,10-,11-/m1/s1 |
| InChIKey | IKOGCQZUKSTIOG-FBIMIBRVSA-N |
| XLogP | 1.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|