C13H27NO5S — CID 129037248
3-(cyclohexylamino)-2-(2-hydroxy-2-methylpropoxy)propane-1-sulfonic acid (PubChem CID 129037248) has the molecular formula C13H27NO5S and a molecular weight of 309.43 g/mol. Its IUPAC name is 3-(cyclohexylamino)-2-(2-hydroxy-2-methylpropoxy)propane-1-sulfonic acid.
| Compound Name | 3-(cyclohexylamino)-2-(2-hydroxy-2-methylpropoxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 129037248 |
| Molecular Formula | C13H27NO5S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3-(cyclohexylamino)-2-(2-hydroxy-2-methylpropoxy)propane-1-sulfonic acid |
| SMILES | CC(C)(O)COC(CNC1CCCCC1)CS(=O)(=O)O |
| InChI | InChI=1S/C13H27NO5S/c1-13(2,15)10-19-12(9-20(16,17)18)8-14-11-6-4-3-5-7-11/h11-12,14-15H,3-10H2,1-2H3,(H,16,17,18) |
| InChIKey | IGGZTTCWWNJYRB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|