C10H20NO4S- — CID 153294161
3-(cyclohexylamino)-2-methoxypropane-1-sulfonate (PubChem CID 153294161) has the molecular formula C10H20NO4S- and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-(cyclohexylamino)-2-methoxypropane-1-sulfonate.
| Compound Name | 3-(cyclohexylamino)-2-methoxypropane-1-sulfonate |
|---|---|
| PubChem CID | 153294161 |
| Molecular Formula | C10H20NO4S- |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-(cyclohexylamino)-2-methoxypropane-1-sulfonate |
| SMILES | COC(CNC1CCCCC1)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H21NO4S/c1-15-10(8-16(12,13)14)7-11-9-5-3-2-4-6-9/h9-11H,2-8H2,1H3,(H,12,13,14)/p-1 |
| InChIKey | XZNJIOKJVUQYOQ-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|