C16H21FNO5S- — CID 153294160
3-(cyclohexylamino)-2-(4-fluorobenzoyl)oxypropane-1-sulfonate (PubChem CID 153294160) has the molecular formula C16H21FNO5S- and a molecular weight of 358.41 g/mol. Its IUPAC name is 3-(cyclohexylamino)-2-(4-fluorobenzoyl)oxypropane-1-sulfonate.
| Compound Name | 3-(cyclohexylamino)-2-(4-fluorobenzoyl)oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 153294160 |
| Molecular Formula | C16H21FNO5S- |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-(cyclohexylamino)-2-(4-fluorobenzoyl)oxypropane-1-sulfonate |
| SMILES | O=C(OC(CNC1CCCCC1)CS(=O)(=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FNO5S/c17-13-8-6-12(7-9-13)16(19)23-15(11-24(20,21)22)10-18-14-4-2-1-3-5-14/h6-9,14-15,18H,1-5,10-11H2,(H,20,21,22)/p-1 |
| InChIKey | RNPHNPCPJVLRLU-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|