C17H25NO7S2 — CID 129037246
3-(cyclohexylamino)-2-(4-methylsulfonylbenzoyl)oxypropane-1-sulfonic acid (PubChem CID 129037246) has the molecular formula C17H25NO7S2 and a molecular weight of 419.52 g/mol. Its IUPAC name is 3-(cyclohexylamino)-2-(4-methylsulfonylbenzoyl)oxypropane-1-sulfonic acid.
| Compound Name | 3-(cyclohexylamino)-2-(4-methylsulfonylbenzoyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129037246 |
| Molecular Formula | C17H25NO7S2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 3-(cyclohexylamino)-2-(4-methylsulfonylbenzoyl)oxypropane-1-sulfonic acid |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OC(CNC2CCCCC2)CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H25NO7S2/c1-26(20,21)16-9-7-13(8-10-16)17(19)25-15(12-27(22,23)24)11-18-14-5-3-2-4-6-14/h7-10,14-15,18H,2-6,11-12H2,1H3,(H,22,23,24) |
| InChIKey | OMLALHNYHRNYPH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|