C27H26N2O2 — CID 129037863
3-methyl-4-[3-[2-phenyl-2-(1-phenylethylamino)ethyl]anilino]cyclobut-3-ene-1,2-dione (PubChem CID 129037863) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-methyl-4-[3-[2-phenyl-2-(1-phenylethylamino)ethyl]anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-methyl-4-[3-[2-phenyl-2-(1-phenylethylamino)ethyl]anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 129037863 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-methyl-4-[3-[2-phenyl-2-(1-phenylethylamino)ethyl]anilino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1c(Nc2cccc(CC(NC(C)c3ccccc3)c3ccccc3)c2)c(=O)c1=O |
| InChI | InChI=1S/C27H26N2O2/c1-18-25(27(31)26(18)30)29-23-15-9-10-20(16-23)17-24(22-13-7-4-8-14-22)28-19(2)21-11-5-3-6-12-21/h3-16,19,24,28-29H,17H2,1-2H3 |
| InChIKey | YAFLCIHLHNSBPH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|