C24H22N4O2 — CID 18334132
3-amino-4-[3-[(1-phenylethylamino)-pyridin-4-ylmethyl]anilino]cyclobut-3-ene-1,2-dione (PubChem CID 18334132) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-amino-4-[3-[(1-phenylethylamino)-pyridin-4-ylmethyl]anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[3-[(1-phenylethylamino)-pyridin-4-ylmethyl]anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 18334132 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-amino-4-[3-[(1-phenylethylamino)-pyridin-4-ylmethyl]anilino]cyclobut-3-ene-1,2-dione |
| SMILES | CC(NC(c1ccncc1)c1cccc(Nc2c(N)c(=O)c2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O2/c1-15(16-6-3-2-4-7-16)27-21(17-10-12-26-13-11-17)18-8-5-9-19(14-18)28-22-20(25)23(29)24(22)30/h2-15,21,27-28H,25H2,1H3 |
| InChIKey | BMYGPAQMMYBSBN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|