C18H18FIO3 — CID 129039351
methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate (PubChem CID 129039351) has the molecular formula C18H18FIO3 and a molecular weight of 428.24 g/mol. Its IUPAC name is methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate.
| Compound Name | methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate |
|---|---|
| PubChem CID | 129039351 |
| Molecular Formula | C18H18FIO3 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate |
| SMILES | COC(=O)Cc1cccc(I)c1COc1cc(C)c(C)cc1F |
| InChI | InChI=1S/C18H18FIO3/c1-11-7-15(19)17(8-12(11)2)23-10-14-13(9-18(21)22-3)5-4-6-16(14)20/h4-8H,9-10H2,1-3H3 |
| InChIKey | MUYITQIRCZVLLC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|