About methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate
methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate (PubChem CID 129039351) has the molecular formula C18H18FIO3
and a molecular weight of 428.24 g/mol. Its IUPAC name is methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate |
| PubChem CID | 129039351 |
| Molecular Formula | C18H18FIO3 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate |
| SMILES | COC(=O)Cc1cccc(I)c1COc1cc(C)c(C)cc1F |
| InChI | InChI=1S/C18H18FIO3/c1-11-7-15(19)17(8-12(11)2)23-10-14-13(9-18(21)22-3)5-4-6-16(14)20/h4-8H,9-10H2,1-3H3 |
| InChIKey | MUYITQIRCZVLLC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate?
The IUPAC name of methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate (CID 129039351) is methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate.
What is the SMILES notation for methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate?
The canonical SMILES for methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate is COC(=O)Cc1cccc(I)c1COc1cc(C)c(C)cc1F.
What is the InChIKey of methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate?
The InChIKey is MUYITQIRCZVLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FIO3/c1-11-7-15(19)17(8-12(11)2)23-10-14-13(9-18(21)22-3)5-4-6-16(14)20/h4-8H,9-10H2,1-3H3.
What are the key properties of methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate?
methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate has a molecular weight of 428.24 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[(2-fluoro-4,5-dimethylphenoxy)methyl]-3-iodophenyl]acetate is sourced from PubChem (CID 129039351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).