C21H24BrClFN5O — CID 129041953
N-(4-bromo-2-chlorophenyl)-4-fluoro-1-methyl-6-[(2-pyrrolidin-1-ylethoxyamino)methyl]benzimidazol-5-amine (PubChem CID 129041953) has the molecular formula C21H24BrClFN5O and a molecular weight of 496.81 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-4-fluoro-1-methyl-6-[(2-pyrrolidin-1-ylethoxyamino)methyl]benzimidazol-5-amine.
| Compound Name | N-(4-bromo-2-chlorophenyl)-4-fluoro-1-methyl-6-[(2-pyrrolidin-1-ylethoxyamino)methyl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 129041953 |
| Molecular Formula | C21H24BrClFN5O |
| Molecular Weight | 496.81 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-4-fluoro-1-methyl-6-[(2-pyrrolidin-1-ylethoxyamino)methyl]benzimidazol-5-amine |
| SMILES | Cn1cnc2c(F)c(Nc3ccc(Br)cc3Cl)c(CNOCCN3CCCC3)cc21 |
| InChI | InChI=1S/C21H24BrClFN5O/c1-28-13-25-21-18(28)10-14(12-26-30-9-8-29-6-2-3-7-29)20(19(21)24)27-17-5-4-15(22)11-16(17)23/h4-5,10-11,13,26-27H,2-3,6-9,12H2,1H3 |
| InChIKey | JMZVPXAEIKDJOY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.81 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|