C35H43N7O4 — CID 129044425
(1-azido-2-methylpropan-2-yl) N-[(2S)-1-(2,2-diphenylethylamino)-1-oxo-6-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]hexan-2-yl]carbamate (PubChem CID 129044425) has the molecular formula C35H43N7O4 and a molecular weight of 625.77 g/mol. Its IUPAC name is (1-azido-2-methylpropan-2-yl) N-[(2S)-1-(2,2-diphenylethylamino)-1-oxo-6-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]hexan-2-yl]carbamate.
| Compound Name | (1-azido-2-methylpropan-2-yl) N-[(2S)-1-(2,2-diphenylethylamino)-1-oxo-6-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 129044425 |
| Molecular Formula | C35H43N7O4 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | (1-azido-2-methylpropan-2-yl) N-[(2S)-1-(2,2-diphenylethylamino)-1-oxo-6-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]hexan-2-yl]carbamate |
| SMILES | CC(C)(CN=[N+]=[N-])OC(=O)N[C@@H](CCCCNC(=O)[C@@H]1Cc2ccccc2CN1)C(=O)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H43N7O4/c1-35(2,24-40-42-36)46-34(45)41-30(19-11-12-20-37-33(44)31-21-27-17-9-10-18-28(27)22-38-31)32(43)39-23-29(25-13-5-3-6-14-25)26-15-7-4-8-16-26/h3-10,13-18,29-31,38H,11-12,19-24H2,1-2H3,(H,37,44)(H,39,43)(H,41,45)/t30-,31-/m0/s1 |
| InChIKey | FWXXLJGGTGVWAN-CONSDPRKSA-N |
| XLogP | 5.12 |
| TPSA | 157.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|