C16H21F3N2O2 — CID 129048470
1-(6-amino-1,1-diethyl-7-methoxy-3,4-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone (PubChem CID 129048470) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 1-(6-amino-1,1-diethyl-7-methoxy-3,4-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(6-amino-1,1-diethyl-7-methoxy-3,4-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 129048470 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(6-amino-1,1-diethyl-7-methoxy-3,4-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone |
| SMILES | CCC1(CC)c2cc(OC)c(N)cc2CCN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O2/c1-4-15(5-2)11-9-13(23-3)12(20)8-10(11)6-7-21(15)14(22)16(17,18)19/h8-9H,4-7,20H2,1-3H3 |
| InChIKey | LDFFMMDYMYUPFZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|