C16H20F3NO2 — CID 157328509
3-(7-amino-6-methoxy-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-yl)-1,1,1-trifluoropropan-2-one (PubChem CID 157328509) has the molecular formula C16H20F3NO2 and a molecular weight of 315.34 g/mol. Its IUPAC name is 3-(7-amino-6-methoxy-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-yl)-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-(7-amino-6-methoxy-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-yl)-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 157328509 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-(7-amino-6-methoxy-1,1-dimethyl-3,4-dihydro-2H-naphthalen-2-yl)-1,1,1-trifluoropropan-2-one |
| SMILES | COc1cc2c(cc1N)C(C)(C)C(CC(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C16H20F3NO2/c1-15(2)10(7-14(21)16(17,18)19)5-4-9-6-13(22-3)12(20)8-11(9)15/h6,8,10H,4-5,7,20H2,1-3H3 |
| InChIKey | ISVUGPNOLQCXPO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|