C12H13BrF3NO2 — CID 158200104
5-(5-amino-2-bromo-4-methoxyphenyl)-1,1,1-trifluoropentan-2-one (PubChem CID 158200104) has the molecular formula C12H13BrF3NO2 and a molecular weight of 340.14 g/mol. Its IUPAC name is 5-(5-amino-2-bromo-4-methoxyphenyl)-1,1,1-trifluoropentan-2-one.
| Compound Name | 5-(5-amino-2-bromo-4-methoxyphenyl)-1,1,1-trifluoropentan-2-one |
|---|---|
| PubChem CID | 158200104 |
| Molecular Formula | C12H13BrF3NO2 |
| Molecular Weight | 340.14 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 5-(5-amino-2-bromo-4-methoxyphenyl)-1,1,1-trifluoropentan-2-one |
| SMILES | COc1cc(Br)c(CCCC(=O)C(F)(F)F)cc1N |
| InChI | InChI=1S/C12H13BrF3NO2/c1-19-10-6-8(13)7(5-9(10)17)3-2-4-11(18)12(14,15)16/h5-6H,2-4,17H2,1H3 |
| InChIKey | JEXOHLZVJYKWJL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.14 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|