C7H7N3O4 — CID 129048679
3-(2,5-dioxopyrrol-1-yl)-N-nitrosopropanamide (PubChem CID 129048679) has the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-nitrosopropanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-nitrosopropanamide |
|---|---|
| PubChem CID | 129048679 |
| Molecular Formula | C7H7N3O4 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-nitrosopropanamide |
| SMILES | O=NNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H7N3O4/c11-5(8-9-14)3-4-10-6(12)1-2-7(10)13/h1-2H,3-4H2,(H,8,11,14) |
| InChIKey | JUZVQRIEQFGGAT-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|