C8H12F3NO2 — CID 129050764
(E)-5,5,5-trifluoro-N-methoxy-N,3-dimethylpent-2-enamide (PubChem CID 129050764) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-N-methoxy-N,3-dimethylpent-2-enamide.
| Compound Name | (E)-5,5,5-trifluoro-N-methoxy-N,3-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 129050764 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (E)-5,5,5-trifluoro-N-methoxy-N,3-dimethylpent-2-enamide |
| SMILES | CON(C)C(=O)/C=C(\C)CC(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2/c1-6(5-8(9,10)11)4-7(13)12(2)14-3/h4H,5H2,1-3H3/b6-4+ |
| InChIKey | OFCQVVPQRRKVNO-GQCTYLIASA-N |
| XLogP | 1.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|