C10H14FNO2 — CID 88885633
(2Z,3E)-2-ethylidene-3-fluoro-N-methoxy-N-methylhexa-3,5-dienamide (PubChem CID 88885633) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is (2Z,3E)-2-ethylidene-3-fluoro-N-methoxy-N-methylhexa-3,5-dienamide.
| Compound Name | (2Z,3E)-2-ethylidene-3-fluoro-N-methoxy-N-methylhexa-3,5-dienamide |
|---|---|
| PubChem CID | 88885633 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (2Z,3E)-2-ethylidene-3-fluoro-N-methoxy-N-methylhexa-3,5-dienamide |
| SMILES | C=C/C=C(F)\C(=C/C)C(=O)N(C)OC |
| InChI | InChI=1S/C10H14FNO2/c1-5-7-9(11)8(6-2)10(13)12(3)14-4/h5-7H,1H2,2-4H3/b8-6+,9-7+ |
| InChIKey | ZYSMTXYMZTUXPS-CDJQDVQCSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|