C11H16FNO — CID 177348094
(2Z,3E)-2-ethylidene-3-fluoro-N,N,4-trimethylhexa-3,5-dienamide (PubChem CID 177348094) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is (2Z,3E)-2-ethylidene-3-fluoro-N,N,4-trimethylhexa-3,5-dienamide.
| Compound Name | (2Z,3E)-2-ethylidene-3-fluoro-N,N,4-trimethylhexa-3,5-dienamide |
|---|---|
| PubChem CID | 177348094 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (2Z,3E)-2-ethylidene-3-fluoro-N,N,4-trimethylhexa-3,5-dienamide |
| SMILES | C=C/C(C)=C(F)\C(=C/C)C(=O)N(C)C |
| InChI | InChI=1S/C11H16FNO/c1-6-8(3)10(12)9(7-2)11(14)13(4)5/h6-7H,1H2,2-5H3/b9-7+,10-8+ |
| InChIKey | TUKXTZZBOGFCGZ-FIFLTTCUSA-N |
| XLogP | 2.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|