C10H10N4O3S — CID 12905319
5-[1-(3-nitrophenoxy)ethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 12905319) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is 5-[1-(3-nitrophenoxy)ethyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[1-(3-nitrophenoxy)ethyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 12905319 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 5-[1-(3-nitrophenoxy)ethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CC(Oc1cccc([N+](=O)[O-])c1)c1nnc(N)s1 |
| InChI | InChI=1S/C10H10N4O3S/c1-6(9-12-13-10(11)18-9)17-8-4-2-3-7(5-8)14(15)16/h2-6H,1H3,(H2,11,13) |
| InChIKey | BNMWGTYJSNKDCM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|