C68H68N2 — CID 129062791
1-N,6-N-bis(3,5-dimethylphenyl)-1-N,6-N-bis[5-(2,6-dimethylphenyl)-2-methylphenyl]-3,8-di(propan-2-yl)pyrene-1,6-diamine (PubChem CID 129062791) has the molecular formula C68H68N2 and a molecular weight of 913.31 g/mol. Its IUPAC name is 1-N,6-N-bis(3,5-dimethylphenyl)-1-N,6-N-bis[5-(2,6-dimethylphenyl)-2-methylphenyl]-3,8-di(propan-2-yl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(3,5-dimethylphenyl)-1-N,6-N-bis[5-(2,6-dimethylphenyl)-2-methylphenyl]-3,8-di(propan-2-yl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 129062791 |
| Molecular Formula | C68H68N2 |
| Molecular Weight | 913.31 g/mol |
| Exact Mass | 912.54 |
| IUPAC Name | 1-N,6-N-bis(3,5-dimethylphenyl)-1-N,6-N-bis[5-(2,6-dimethylphenyl)-2-methylphenyl]-3,8-di(propan-2-yl)pyrene-1,6-diamine |
| SMILES | Cc1cc(C)cc(N(c2cc(-c3c(C)cccc3C)ccc2C)c2cc(C(C)C)c3ccc4c(N(c5cc(C)cc(C)c5)c5cc(-c6c(C)cccc6C)ccc5C)cc(C(C)C)c5ccc2c3c54)c1 |
| InChI | InChI=1S/C68H68N2/c1-39(2)59-37-63(69(53-31-41(5)29-42(6)32-53)61-35-51(23-21-45(61)9)65-47(11)17-15-18-48(65)12)57-28-26-56-60(40(3)4)38-64(58-27-25-55(59)67(57)68(56)58)70(54-33-43(7)30-44(8)34-54)62-36-52(24-22-46(62)10)66-49(13)19-16-20-50(66)14/h15-40H,1-14H3 |
| InChIKey | DTNZVSGZXBYBGX-UHFFFAOYSA-N |
| XLogP | 20.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.31 |
| LogP ≤ 5 | 20.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|