C15H24N4O3 — CID 129064982
N-[(1E,3E)-4-(4-morpholin-4-ylpiperidin-1-yl)-1-nitropenta-1,3-dienyl]methanimine (PubChem CID 129064982) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(1E,3E)-4-(4-morpholin-4-ylpiperidin-1-yl)-1-nitropenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-4-(4-morpholin-4-ylpiperidin-1-yl)-1-nitropenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 129064982 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | N-[(1E,3E)-4-(4-morpholin-4-ylpiperidin-1-yl)-1-nitropenta-1,3-dienyl]methanimine |
| SMILES | C=N/C(=C\C=C(/C)N1CCC(N2CCOCC2)CC1)[N+](=O)[O-] |
| InChI | InChI=1S/C15H24N4O3/c1-13(3-4-15(16-2)19(20)21)17-7-5-14(6-8-17)18-9-11-22-12-10-18/h3-4,14H,2,5-12H2,1H3/b13-3+,15-4+ |
| InChIKey | NRSLMNYWSAHPIJ-UWCGVHETSA-N |
| XLogP | 1.51 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|