C27H33N7O6 — CID 129065815
ethyl (2S,4R)-4-[4-[[2-[[2-[4-[(4-aminophenyl)diazenyl]anilino]-2-oxoethyl]amino]-2-oxoethyl]amino]-4-oxobutyl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 129065815) has the molecular formula C27H33N7O6 and a molecular weight of 551.60 g/mol. Its IUPAC name is ethyl (2S,4R)-4-[4-[[2-[[2-[4-[(4-aminophenyl)diazenyl]anilino]-2-oxoethyl]amino]-2-oxoethyl]amino]-4-oxobutyl]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4R)-4-[4-[[2-[[2-[4-[(4-aminophenyl)diazenyl]anilino]-2-oxoethyl]amino]-2-oxoethyl]amino]-4-oxobutyl]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 129065815 |
| Molecular Formula | C27H33N7O6 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | ethyl (2S,4R)-4-[4-[[2-[[2-[4-[(4-aminophenyl)diazenyl]anilino]-2-oxoethyl]amino]-2-oxoethyl]amino]-4-oxobutyl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](CCCC(=O)NCC(=O)NCC(=O)Nc2ccc(/N=N/c3ccc(N)cc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C27H33N7O6/c1-2-40-27(39)22-14-17(26(38)32-22)4-3-5-23(35)29-15-24(36)30-16-25(37)31-19-10-12-21(13-11-19)34-33-20-8-6-18(28)7-9-20/h6-13,17,22H,2-5,14-16,28H2,1H3,(H,29,35)(H,30,36)(H,31,37)(H,32,38)/b34-33+/t17-,22+/m1/s1 |
| InChIKey | MZNONTNLZFJGRU-WFGBHNIXSA-N |
| XLogP | 2.09 |
| TPSA | 193.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|