C20H26N2O6S — CID 41475292
ethyl (3S,6R)-6-[2-(4-butoxycarbonylanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate (PubChem CID 41475292) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is ethyl (3S,6R)-6-[2-(4-butoxycarbonylanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate.
| Compound Name | ethyl (3S,6R)-6-[2-(4-butoxycarbonylanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 41475292 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | ethyl (3S,6R)-6-[2-(4-butoxycarbonylanilino)-2-oxoethyl]-5-oxothiomorpholine-3-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C[C@H]2SC[C@H](C(=O)OCC)NC2=O)cc1 |
| InChI | InChI=1S/C20H26N2O6S/c1-3-5-10-28-19(25)13-6-8-14(9-7-13)21-17(23)11-16-18(24)22-15(12-29-16)20(26)27-4-2/h6-9,15-16H,3-5,10-12H2,1-2H3,(H,21,23)(H,22,24)/t15-,16-/m1/s1 |
| InChIKey | UULUDGTVAZNTNV-HZPDHXFCSA-N |
| XLogP | 2.14 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|