C17H21N5O4S — CID 154777176
butyl 4-[[2-(2-carbamimidoylimino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]benzoate (PubChem CID 154777176) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is butyl 4-[[2-(2-carbamimidoylimino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(2-carbamimidoylimino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 154777176 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | butyl 4-[[2-(2-carbamimidoylimino-4-oxo-1,3-thiazolidin-5-yl)acetyl]amino]benzoate |
| SMILES | [H]/N=C(\N)N=C1NC(=O)C(CC(=O)Nc2ccc(C(=O)OCCCC)cc2)S1 |
| InChI | InChI=1S/C17H21N5O4S/c1-2-3-8-26-15(25)10-4-6-11(7-5-10)20-13(23)9-12-14(24)21-17(27-12)22-16(18)19/h4-7,12H,2-3,8-9H2,1H3,(H,20,23)(H4,18,19,21,22,24) |
| InChIKey | UWZLAPJSIPJSOB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 146.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|