C16H11F5O8S2 — CID 129070720
2-[4-(benzenesulfonyloxy)benzoyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 129070720) has the molecular formula C16H11F5O8S2 and a molecular weight of 490.38 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyloxy)benzoyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-[4-(benzenesulfonyloxy)benzoyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 129070720 |
| Molecular Formula | C16H11F5O8S2 |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 2-[4-(benzenesulfonyloxy)benzoyl]oxy-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H11F5O8S2/c17-15(18,19)14(16(20,21)31(25,26)27)28-13(22)10-6-8-11(9-7-10)29-30(23,24)12-4-2-1-3-5-12/h1-9,14H,(H,25,26,27) |
| InChIKey | GRBDSGYYUGVWTG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|