C32H36O2 — CID 129081670
3-[2-[4-(3-benzoylphenyl)phenyl]ethyl]-3,5,5,6-tetramethylhept-6-en-2-one (PubChem CID 129081670) has the molecular formula C32H36O2 and a molecular weight of 452.64 g/mol. Its IUPAC name is 3-[2-[4-(3-benzoylphenyl)phenyl]ethyl]-3,5,5,6-tetramethylhept-6-en-2-one.
| Compound Name | 3-[2-[4-(3-benzoylphenyl)phenyl]ethyl]-3,5,5,6-tetramethylhept-6-en-2-one |
|---|---|
| PubChem CID | 129081670 |
| Molecular Formula | C32H36O2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 3-[2-[4-(3-benzoylphenyl)phenyl]ethyl]-3,5,5,6-tetramethylhept-6-en-2-one |
| SMILES | C=C(C)C(C)(C)CC(C)(CCc1ccc(-c2cccc(C(=O)c3ccccc3)c2)cc1)C(C)=O |
| InChI | InChI=1S/C32H36O2/c1-23(2)31(4,5)22-32(6,24(3)33)20-19-25-15-17-26(18-16-25)28-13-10-14-29(21-28)30(34)27-11-8-7-9-12-27/h7-18,21H,1,19-20,22H2,2-6H3 |
| InChIKey | PLXJGDZPRBECGN-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|