C32H32O3 — CID 129081682
[3-[4-(3,5-dihydroxy-5-methyl-3-phenylhexyl)phenyl]phenyl]-phenylmethanone (PubChem CID 129081682) has the molecular formula C32H32O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is [3-[4-(3,5-dihydroxy-5-methyl-3-phenylhexyl)phenyl]phenyl]-phenylmethanone.
| Compound Name | [3-[4-(3,5-dihydroxy-5-methyl-3-phenylhexyl)phenyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 129081682 |
| Molecular Formula | C32H32O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [3-[4-(3,5-dihydroxy-5-methyl-3-phenylhexyl)phenyl]phenyl]-phenylmethanone |
| SMILES | CC(C)(O)CC(O)(CCc1ccc(-c2cccc(C(=O)c3ccccc3)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H32O3/c1-31(2,34)23-32(35,29-14-7-4-8-15-29)21-20-24-16-18-25(19-17-24)27-12-9-13-28(22-27)30(33)26-10-5-3-6-11-26/h3-19,22,34-35H,20-21,23H2,1-2H3 |
| InChIKey | UTCVKZYQRPZCQJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |