C23H25NO5S — CID 129084137
methyl 6-(benzenesulfinylmethyl)-2-[2-(dimethylamino)ethoxy]-3-(furan-3-yl)benzoate (PubChem CID 129084137) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is methyl 6-(benzenesulfinylmethyl)-2-[2-(dimethylamino)ethoxy]-3-(furan-3-yl)benzoate.
| Compound Name | methyl 6-(benzenesulfinylmethyl)-2-[2-(dimethylamino)ethoxy]-3-(furan-3-yl)benzoate |
|---|---|
| PubChem CID | 129084137 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | methyl 6-(benzenesulfinylmethyl)-2-[2-(dimethylamino)ethoxy]-3-(furan-3-yl)benzoate |
| SMILES | COC(=O)c1c(CS(=O)c2ccccc2)ccc(-c2ccoc2)c1OCCN(C)C |
| InChI | InChI=1S/C23H25NO5S/c1-24(2)12-14-29-22-20(17-11-13-28-15-17)10-9-18(21(22)23(25)27-3)16-30(26)19-7-5-4-6-8-19/h4-11,13,15H,12,14,16H2,1-3H3 |
| InChIKey | JRDMOCOHAXDUNV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |