About tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate
tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate (PubChem CID 174655478) has the molecular formula C27H31NO8S
and a molecular weight of 529.61 g/mol. Its IUPAC name is tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate.
Molecular Properties
| Compound Name | tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate |
| PubChem CID | 174655478 |
| Molecular Formula | C27H31NO8S |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate |
| SMILES | CC(C)(C)OC=O.COC(=O)c1c(CS(=O)(=O)c2ccccc2)ccc(-c2ccoc2)c1ON1CCC1 |
| InChI | InChI=1S/C22H21NO6S.C5H10O2/c1-27-22(24)20-17(15-30(25,26)18-6-3-2-4-7-18)8-9-19(16-10-13-28-14-16)21(20)29-23-11-5-12-23;1-5(2,3)7-4-6/h2-4,6-10,13-14H,5,11-12,15H2,1H3;4H,1-3H3 |
| InChIKey | OJMVCCHGOOIPLM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate?
The IUPAC name of tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate (CID 174655478) is tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate.
What is the SMILES notation for tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate?
The canonical SMILES for tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate is CC(C)(C)OC=O.COC(=O)c1c(CS(=O)(=O)c2ccccc2)ccc(-c2ccoc2)c1ON1CCC1.
What is the InChIKey of tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate?
The InChIKey is OJMVCCHGOOIPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO6S.C5H10O2/c1-27-22(24)20-17(15-30(25,26)18-6-3-2-4-7-18)8-9-19(16-10-13-28-14-16)21(20)29-23-11-5-12-23;1-5(2,3)7-4-6/h2-4,6-10,13-14H,5,11-12,15H2,1H3;4H,1-3H3.
What are the key properties of tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate?
tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate has a molecular weight of 529.61 g/mol, XLogP of 4.66, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate is sourced from PubChem (CID 174655478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).