C27H31NO8S — CID 174655478
tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate (PubChem CID 174655478) has the molecular formula C27H31NO8S and a molecular weight of 529.61 g/mol. Its IUPAC name is tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate.
| Compound Name | tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate |
|---|---|
| PubChem CID | 174655478 |
| Molecular Formula | C27H31NO8S |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | tert-butyl formate;methyl 2-(azetidin-1-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate |
| SMILES | CC(C)(C)OC=O.COC(=O)c1c(CS(=O)(=O)c2ccccc2)ccc(-c2ccoc2)c1ON1CCC1 |
| InChI | InChI=1S/C22H21NO6S.C5H10O2/c1-27-22(24)20-17(15-30(25,26)18-6-3-2-4-7-18)8-9-19(16-10-13-28-14-16)21(20)29-23-11-5-12-23;1-5(2,3)7-4-6/h2-4,6-10,13-14H,5,11-12,15H2,1H3;4H,1-3H3 |
| InChIKey | OJMVCCHGOOIPLM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|