C18H14O5S — CID 67107847
2-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoic acid (PubChem CID 67107847) has the molecular formula C18H14O5S and a molecular weight of 342.37 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoic acid.
| Compound Name | 2-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoic acid |
|---|---|
| PubChem CID | 67107847 |
| Molecular Formula | C18H14O5S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccoc2)c1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14O5S/c19-18(20)16-8-4-7-15(13-9-10-23-11-13)17(16)12-24(21,22)14-5-2-1-3-6-14/h1-11H,12H2,(H,19,20) |
| InChIKey | FKVNEQIILSHUQR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |