C21H21NO6S — CID 67107665
2-(3-aminopropoxy)-4-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoic acid (PubChem CID 67107665) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-(3-aminopropoxy)-4-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoic acid.
| Compound Name | 2-(3-aminopropoxy)-4-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoic acid |
|---|---|
| PubChem CID | 67107665 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-(3-aminopropoxy)-4-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoic acid |
| SMILES | NCCCOc1c(C(=O)O)ccc(CS(=O)(=O)c2ccccc2)c1-c1ccoc1 |
| InChI | InChI=1S/C21H21NO6S/c22-10-4-11-28-20-18(21(23)24)8-7-16(19(20)15-9-12-27-13-15)14-29(25,26)17-5-2-1-3-6-17/h1-3,5-9,12-13H,4,10-11,14,22H2,(H,23,24) |
| InChIKey | ZWJVCPWHBCLBIW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|