C21H20N2O5S — CID 123656338
6-(benzenesulfonylmethyl)-3-(furan-3-yl)-2-(2-methyliminoethylamino)benzoic acid (PubChem CID 123656338) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-3-(furan-3-yl)-2-(2-methyliminoethylamino)benzoic acid.
| Compound Name | 6-(benzenesulfonylmethyl)-3-(furan-3-yl)-2-(2-methyliminoethylamino)benzoic acid |
|---|---|
| PubChem CID | 123656338 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-3-(furan-3-yl)-2-(2-methyliminoethylamino)benzoic acid |
| SMILES | C/N=C/CNc1c(-c2ccoc2)ccc(CS(=O)(=O)c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C21H20N2O5S/c1-22-10-11-23-20-18(15-9-12-28-13-15)8-7-16(19(20)21(24)25)14-29(26,27)17-5-3-2-4-6-17/h2-10,12-13,23H,11,14H2,1H3,(H,24,25)/b22-10+ |
| InChIKey | RONBMGXTNZKBQL-LSHDLFTRSA-N |
| XLogP | 3.73 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|