C20H18O7S — CID 52913531
6-(benzenesulfonylmethyl)-3-(furan-3-yl)-2,4-dimethoxybenzoic acid (PubChem CID 52913531) has the molecular formula C20H18O7S and a molecular weight of 402.42 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-3-(furan-3-yl)-2,4-dimethoxybenzoic acid.
| Compound Name | 6-(benzenesulfonylmethyl)-3-(furan-3-yl)-2,4-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 52913531 |
| Molecular Formula | C20H18O7S |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-3-(furan-3-yl)-2,4-dimethoxybenzoic acid |
| SMILES | COc1cc(CS(=O)(=O)c2ccccc2)c(C(=O)O)c(OC)c1-c1ccoc1 |
| InChI | InChI=1S/C20H18O7S/c1-25-16-10-14(12-28(23,24)15-6-4-3-5-7-15)18(20(21)22)19(26-2)17(16)13-8-9-27-11-13/h3-11H,12H2,1-2H3,(H,21,22) |
| InChIKey | VLVASWQSXZNLJJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |