C26H27NO7S — CID 174655486
2,2-dimethylpropanoyl 2-(azetidin-3-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate (PubChem CID 174655486) has the molecular formula C26H27NO7S and a molecular weight of 497.57 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl 2-(azetidin-3-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate.
| Compound Name | 2,2-dimethylpropanoyl 2-(azetidin-3-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate |
|---|---|
| PubChem CID | 174655486 |
| Molecular Formula | C26H27NO7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 2,2-dimethylpropanoyl 2-(azetidin-3-yloxy)-6-(benzenesulfonylmethyl)-3-(furan-3-yl)benzoate |
| SMILES | CC(C)(C)C(=O)OC(=O)c1c(CS(=O)(=O)c2ccccc2)ccc(-c2ccoc2)c1OC1CNC1 |
| InChI | InChI=1S/C26H27NO7S/c1-26(2,3)25(29)34-24(28)22-18(16-35(30,31)20-7-5-4-6-8-20)9-10-21(17-11-12-32-15-17)23(22)33-19-13-27-14-19/h4-12,15,19,27H,13-14,16H2,1-3H3 |
| InChIKey | NEGRIPVIZVCRDM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|