C27H29FO8S — CID 158559169
methyl 6-[(4-fluorophenyl)sulfonylmethyl]-3-(furan-3-yl)-2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]benzoate (PubChem CID 158559169) has the molecular formula C27H29FO8S and a molecular weight of 532.59 g/mol. Its IUPAC name is methyl 6-[(4-fluorophenyl)sulfonylmethyl]-3-(furan-3-yl)-2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]benzoate.
| Compound Name | methyl 6-[(4-fluorophenyl)sulfonylmethyl]-3-(furan-3-yl)-2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]benzoate |
|---|---|
| PubChem CID | 158559169 |
| Molecular Formula | C27H29FO8S |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | methyl 6-[(4-fluorophenyl)sulfonylmethyl]-3-(furan-3-yl)-2-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]benzoate |
| SMILES | COC(=O)c1c(CS(=O)(=O)c2ccc(F)cc2)ccc(-c2ccoc2)c1OCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H29FO8S/c1-27(2,3)36-23(29)6-5-14-35-25-22(18-13-15-34-16-18)12-7-19(24(25)26(30)33-4)17-37(31,32)21-10-8-20(28)9-11-21/h7-13,15-16H,5-6,14,17H2,1-4H3 |
| InChIKey | HQRAEZCIVUWHHS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|