C20H16O7S — CID 86684730
methyl 6-(benzenesulfonylmethyl)-3-(2-formylfuran-3-yl)-2-hydroxybenzoate (PubChem CID 86684730) has the molecular formula C20H16O7S and a molecular weight of 400.41 g/mol. Its IUPAC name is methyl 6-(benzenesulfonylmethyl)-3-(2-formylfuran-3-yl)-2-hydroxybenzoate.
| Compound Name | methyl 6-(benzenesulfonylmethyl)-3-(2-formylfuran-3-yl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 86684730 |
| Molecular Formula | C20H16O7S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | methyl 6-(benzenesulfonylmethyl)-3-(2-formylfuran-3-yl)-2-hydroxybenzoate |
| SMILES | COC(=O)c1c(CS(=O)(=O)c2ccccc2)ccc(-c2ccoc2C=O)c1O |
| InChI | InChI=1S/C20H16O7S/c1-26-20(23)18-13(12-28(24,25)14-5-3-2-4-6-14)7-8-16(19(18)22)15-9-10-27-17(15)11-21/h2-11,22H,12H2,1H3 |
| InChIKey | KAIKFLWZNHOATL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|