C25H24F3NO6S — CID 123754164
tert-butyl 3-(furan-3-yl)-2-methoxy-6-[[oxo-phenyl-[(2,2,2-trifluoroacetyl)amino]-λ6-sulfanylidene]methyl]benzoate (PubChem CID 123754164) has the molecular formula C25H24F3NO6S and a molecular weight of 523.53 g/mol. Its IUPAC name is tert-butyl 3-(furan-3-yl)-2-methoxy-6-[[oxo-phenyl-[(2,2,2-trifluoroacetyl)amino]-λ6-sulfanylidene]methyl]benzoate.
| Compound Name | tert-butyl 3-(furan-3-yl)-2-methoxy-6-[[oxo-phenyl-[(2,2,2-trifluoroacetyl)amino]-λ6-sulfanylidene]methyl]benzoate |
|---|---|
| PubChem CID | 123754164 |
| Molecular Formula | C25H24F3NO6S |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | tert-butyl 3-(furan-3-yl)-2-methoxy-6-[[oxo-phenyl-[(2,2,2-trifluoroacetyl)amino]-λ6-sulfanylidene]methyl]benzoate |
| SMILES | COc1c(-c2ccoc2)ccc(C=S(=O)(NC(=O)C(F)(F)F)c2ccccc2)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H24F3NO6S/c1-24(2,3)35-22(30)20-17(10-11-19(21(20)33-4)16-12-13-34-14-16)15-36(32,18-8-6-5-7-9-18)29-23(31)25(26,27)28/h5-15H,1-4H3,(H,29,31,32) |
| InChIKey | PPXOVEMNDLQBIW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|